C11H16O3S — CID 19066239
2-methyl-1-(4-methylsulfonylphenyl)propan-2-ol (PubChem CID 19066239) has the molecular formula C11H16O3S and a molecular weight of 228.31 g/mol. Its IUPAC name is 2-methyl-1-(4-methylsulfonylphenyl)propan-2-ol.
| Compound Name | 2-methyl-1-(4-methylsulfonylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 19066239 |
| Molecular Formula | C11H16O3S |
| Molecular Weight | 228.31 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-methyl-1-(4-methylsulfonylphenyl)propan-2-ol |
| SMILES | CC(C)(O)Cc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C11H16O3S/c1-11(2,12)8-9-4-6-10(7-5-9)15(3,13)14/h4-7,12H,8H2,1-3H3 |
| InChIKey | ZYMLMBSEEIZLLT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |