C10H15NO3S — CID 62773186
1-amino-2-(4-methylsulfonylphenyl)propan-2-ol (PubChem CID 62773186) has the molecular formula C10H15NO3S and a molecular weight of 229.30 g/mol. Its IUPAC name is 1-amino-2-(4-methylsulfonylphenyl)propan-2-ol.
| Compound Name | 1-amino-2-(4-methylsulfonylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 62773186 |
| Molecular Formula | C10H15NO3S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | 1-amino-2-(4-methylsulfonylphenyl)propan-2-ol |
| SMILES | CC(O)(CN)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C10H15NO3S/c1-10(12,7-11)8-3-5-9(6-4-8)15(2,13)14/h3-6,12H,7,11H2,1-2H3 |
| InChIKey | IUYNVFZTTJLPCA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |