C23H22O7S3 — CID 150870530
2,2,2-tris(4-methylsulfonylphenyl)acetaldehyde (PubChem CID 150870530) has the molecular formula C23H22O7S3 and a molecular weight of 506.62 g/mol. Its IUPAC name is 2,2,2-tris(4-methylsulfonylphenyl)acetaldehyde.
| Compound Name | 2,2,2-tris(4-methylsulfonylphenyl)acetaldehyde |
|---|---|
| PubChem CID | 150870530 |
| Molecular Formula | C23H22O7S3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 2,2,2-tris(4-methylsulfonylphenyl)acetaldehyde |
| SMILES | CS(=O)(=O)c1ccc(C(C=O)(c2ccc(S(C)(=O)=O)cc2)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C23H22O7S3/c1-31(25,26)20-10-4-17(5-11-20)23(16-24,18-6-12-21(13-7-18)32(2,27)28)19-8-14-22(15-9-19)33(3,29)30/h4-16H,1-3H3 |
| InChIKey | KTYGAENFNHPSCP-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 119.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|