About formic acid;4-methylsulfonylphenol
formic acid;4-methylsulfonylphenol (PubChem CID 175318493) has the molecular formula C8H10O5S
and a molecular weight of 218.23 g/mol. Its IUPAC name is formic acid;4-methylsulfonylphenol.
Molecular Properties
| Compound Name | formic acid;4-methylsulfonylphenol |
| PubChem CID | 175318493 |
| Molecular Formula | C8H10O5S |
| Molecular Weight | 218.23 g/mol |
| Exact Mass | 218.02 |
| IUPAC Name | formic acid;4-methylsulfonylphenol |
| SMILES | CS(=O)(=O)c1ccc(O)cc1.O=CO |
| InChI | InChI=1S/C7H8O3S.CH2O2/c1-11(9,10)7-4-2-6(8)3-5-7;2-1-3/h2-5,8H,1H3;1H,(H,2,3) |
| InChIKey | DEZGLJGKYKDGAG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formic acid;4-methylsulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;4-methylsulfonylphenol?
The IUPAC name of formic acid;4-methylsulfonylphenol (CID 175318493) is formic acid;4-methylsulfonylphenol.
What is the SMILES notation for formic acid;4-methylsulfonylphenol?
The canonical SMILES for formic acid;4-methylsulfonylphenol is CS(=O)(=O)c1ccc(O)cc1.O=CO.
What is the InChIKey of formic acid;4-methylsulfonylphenol?
The InChIKey is DEZGLJGKYKDGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.CH2O2/c1-11(9,10)7-4-2-6(8)3-5-7;2-1-3/h2-5,8H,1H3;1H,(H,2,3).
What are the key properties of formic acid;4-methylsulfonylphenol?
formic acid;4-methylsulfonylphenol has a molecular weight of 218.23 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;4-methylsulfonylphenol is sourced from PubChem (CID 175318493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).