About methane;methylsulfonylbenzene;4-methylsulfonylphenol
methane;methylsulfonylbenzene;4-methylsulfonylphenol (PubChem CID 161395670) has the molecular formula C15H20O5S2
and a molecular weight of 344.45 g/mol. Its IUPAC name is methane;methylsulfonylbenzene;4-methylsulfonylphenol.
Molecular Properties
| Compound Name | methane;methylsulfonylbenzene;4-methylsulfonylphenol |
| PubChem CID | 161395670 |
| Molecular Formula | C15H20O5S2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methane;methylsulfonylbenzene;4-methylsulfonylphenol |
| SMILES | C.CS(=O)(=O)c1ccc(O)cc1.CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O3S.C7H8O2S.CH4/c1-11(9,10)7-4-2-6(8)3-5-7;1-10(8,9)7-5-3-2-4-6-7;/h2-5,8H,1H3;2-6H,1H3;1H4 |
| InChIKey | VTOHPXZTCWEEDM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methane;methylsulfonylbenzene;4-methylsulfonylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methylsulfonylbenzene;4-methylsulfonylphenol?
The IUPAC name of methane;methylsulfonylbenzene;4-methylsulfonylphenol (CID 161395670) is methane;methylsulfonylbenzene;4-methylsulfonylphenol.
What is the SMILES notation for methane;methylsulfonylbenzene;4-methylsulfonylphenol?
The canonical SMILES for methane;methylsulfonylbenzene;4-methylsulfonylphenol is C.CS(=O)(=O)c1ccc(O)cc1.CS(=O)(=O)c1ccccc1.
What is the InChIKey of methane;methylsulfonylbenzene;4-methylsulfonylphenol?
The InChIKey is VTOHPXZTCWEEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S.C7H8O2S.CH4/c1-11(9,10)7-4-2-6(8)3-5-7;1-10(8,9)7-5-3-2-4-6-7;/h2-5,8H,1H3;2-6H,1H3;1H4.
What are the key properties of methane;methylsulfonylbenzene;4-methylsulfonylphenol?
methane;methylsulfonylbenzene;4-methylsulfonylphenol has a molecular weight of 344.45 g/mol, XLogP of 2.52, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methylsulfonylbenzene;4-methylsulfonylphenol is sourced from PubChem (CID 161395670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).