About ethylsulfonylbenzene;phenol
ethylsulfonylbenzene;phenol (PubChem CID 174951751) has the molecular formula C14H16O3S
and a molecular weight of 264.35 g/mol. Its IUPAC name is ethylsulfonylbenzene;phenol.
Molecular Properties
| Compound Name | ethylsulfonylbenzene;phenol |
| PubChem CID | 174951751 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | ethylsulfonylbenzene;phenol |
| SMILES | CCS(=O)(=O)c1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H10O2S.C6H6O/c1-2-11(9,10)8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h3-7H,2H2,1H3;1-5,7H |
| InChIKey | GLEVQYHYBBUZJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethylsulfonylbenzene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylsulfonylbenzene;phenol?
The IUPAC name of ethylsulfonylbenzene;phenol (CID 174951751) is ethylsulfonylbenzene;phenol.
What is the SMILES notation for ethylsulfonylbenzene;phenol?
The canonical SMILES for ethylsulfonylbenzene;phenol is CCS(=O)(=O)c1ccccc1.Oc1ccccc1.
What is the InChIKey of ethylsulfonylbenzene;phenol?
The InChIKey is GLEVQYHYBBUZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S.C6H6O/c1-2-11(9,10)8-6-4-3-5-7-8;7-6-4-2-1-3-5-6/h3-7H,2H2,1H3;1-5,7H.
What are the key properties of ethylsulfonylbenzene;phenol?
ethylsulfonylbenzene;phenol has a molecular weight of 264.35 g/mol, XLogP of 2.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylsulfonylbenzene;phenol is sourced from PubChem (CID 174951751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).