C14H21NO4S — CID 65236567
ethyl 3-(methylamino)-3-(4-methylsulfonylphenyl)butanoate (PubChem CID 65236567) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is ethyl 3-(methylamino)-3-(4-methylsulfonylphenyl)butanoate.
| Compound Name | ethyl 3-(methylamino)-3-(4-methylsulfonylphenyl)butanoate |
|---|---|
| PubChem CID | 65236567 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | ethyl 3-(methylamino)-3-(4-methylsulfonylphenyl)butanoate |
| SMILES | CCOC(=O)CC(C)(NC)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-5-19-13(16)10-14(2,15-3)11-6-8-12(9-7-11)20(4,17)18/h6-9,15H,5,10H2,1-4H3 |
| InChIKey | XANOMIMDPCDIAP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |