C13H18O6S2 — CID 67324129
ethyl 2-methyl-2-(4-methylsulfonylphenyl)sulfonylpropanoate (PubChem CID 67324129) has the molecular formula C13H18O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is ethyl 2-methyl-2-(4-methylsulfonylphenyl)sulfonylpropanoate.
| Compound Name | ethyl 2-methyl-2-(4-methylsulfonylphenyl)sulfonylpropanoate |
|---|---|
| PubChem CID | 67324129 |
| Molecular Formula | C13H18O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl 2-methyl-2-(4-methylsulfonylphenyl)sulfonylpropanoate |
| SMILES | CCOC(=O)C(C)(C)S(=O)(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H18O6S2/c1-5-19-12(14)13(2,3)21(17,18)11-8-6-10(7-9-11)20(4,15)16/h6-9H,5H2,1-4H3 |
| InChIKey | VJOPHDVCNNUQGN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |