C14H20O5S — CID 79298361
ethyl 2-hydroxy-2-methyl-3-(4-methylsulfonylphenyl)butanoate (PubChem CID 79298361) has the molecular formula C14H20O5S and a molecular weight of 300.38 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-methyl-3-(4-methylsulfonylphenyl)butanoate.
| Compound Name | ethyl 2-hydroxy-2-methyl-3-(4-methylsulfonylphenyl)butanoate |
|---|---|
| PubChem CID | 79298361 |
| Molecular Formula | C14H20O5S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | ethyl 2-hydroxy-2-methyl-3-(4-methylsulfonylphenyl)butanoate |
| SMILES | CCOC(=O)C(C)(O)C(C)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H20O5S/c1-5-19-13(15)14(3,16)10(2)11-6-8-12(9-7-11)20(4,17)18/h6-10,16H,5H2,1-4H3 |
| InChIKey | HRRBDSWHRXLTOA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |