C15H23NO4S — CID 60796388
ethyl 2-(4-methylsulfonylphenyl)-2-(propylamino)propanoate (PubChem CID 60796388) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is ethyl 2-(4-methylsulfonylphenyl)-2-(propylamino)propanoate.
| Compound Name | ethyl 2-(4-methylsulfonylphenyl)-2-(propylamino)propanoate |
|---|---|
| PubChem CID | 60796388 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 2-(4-methylsulfonylphenyl)-2-(propylamino)propanoate |
| SMILES | CCCNC(C)(C(=O)OCC)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C15H23NO4S/c1-5-11-16-15(3,14(17)20-6-2)12-7-9-13(10-8-12)21(4,18)19/h7-10,16H,5-6,11H2,1-4H3 |
| InChIKey | PSWZOJRHNKPVOW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |