C17H27NO2 — CID 60796519
ethyl 2-(4-propan-2-ylphenyl)-2-(propylamino)propanoate (PubChem CID 60796519) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is ethyl 2-(4-propan-2-ylphenyl)-2-(propylamino)propanoate.
| Compound Name | ethyl 2-(4-propan-2-ylphenyl)-2-(propylamino)propanoate |
|---|---|
| PubChem CID | 60796519 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | ethyl 2-(4-propan-2-ylphenyl)-2-(propylamino)propanoate |
| SMILES | CCCNC(C)(C(=O)OCC)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C17H27NO2/c1-6-12-18-17(5,16(19)20-7-2)15-10-8-14(9-11-15)13(3)4/h8-11,13,18H,6-7,12H2,1-5H3 |
| InChIKey | XVEDHCURFFIXKO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |