C15H23NO2 — CID 79848294
ethyl 3-amino-3-(4-propan-2-ylphenyl)butanoate (PubChem CID 79848294) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is ethyl 3-amino-3-(4-propan-2-ylphenyl)butanoate.
| Compound Name | ethyl 3-amino-3-(4-propan-2-ylphenyl)butanoate |
|---|---|
| PubChem CID | 79848294 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | ethyl 3-amino-3-(4-propan-2-ylphenyl)butanoate |
| SMILES | CCOC(=O)CC(C)(N)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-5-18-14(17)10-15(4,16)13-8-6-12(7-9-13)11(2)3/h6-9,11H,5,10,16H2,1-4H3 |
| InChIKey | VSVGMETXVRTLBW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |