C13H17NO4S — CID 103233948
ethyl 2-[(4-methylsulfonylanilino)methyl]prop-2-enoate (PubChem CID 103233948) has the molecular formula C13H17NO4S and a molecular weight of 283.35 g/mol. Its IUPAC name is ethyl 2-[(4-methylsulfonylanilino)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(4-methylsulfonylanilino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103233948 |
| Molecular Formula | C13H17NO4S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | ethyl 2-[(4-methylsulfonylanilino)methyl]prop-2-enoate |
| SMILES | C=C(CNc1ccc(S(C)(=O)=O)cc1)C(=O)OCC |
| InChI | InChI=1S/C13H17NO4S/c1-4-18-13(15)10(2)9-14-11-5-7-12(8-6-11)19(3,16)17/h5-8,14H,2,4,9H2,1,3H3 |
| InChIKey | UCSLKZDAMVFFMX-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|