C12H12F3NO2 — CID 103255006
ethyl 2-[(2,4,6-trifluoroanilino)methyl]prop-2-enoate (PubChem CID 103255006) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is ethyl 2-[(2,4,6-trifluoroanilino)methyl]prop-2-enoate.
| Compound Name | ethyl 2-[(2,4,6-trifluoroanilino)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 103255006 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | ethyl 2-[(2,4,6-trifluoroanilino)methyl]prop-2-enoate |
| SMILES | C=C(CNc1c(F)cc(F)cc1F)C(=O)OCC |
| InChI | InChI=1S/C12H12F3NO2/c1-3-18-12(17)7(2)6-16-11-9(14)4-8(13)5-10(11)15/h4-5,16H,2-3,6H2,1H3 |
| InChIKey | IHWJKVKGBILIFX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|