C15H20O7S — CID 135197357
2-[(2-methylpropan-2-yl)oxy]-2-[(4-methylsulfonylphenyl)methyl]propanedioic acid (PubChem CID 135197357) has the molecular formula C15H20O7S and a molecular weight of 344.38 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]-2-[(4-methylsulfonylphenyl)methyl]propanedioic acid.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]-2-[(4-methylsulfonylphenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 135197357 |
| Molecular Formula | C15H20O7S |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]-2-[(4-methylsulfonylphenyl)methyl]propanedioic acid |
| SMILES | CC(C)(C)OC(Cc1ccc(S(C)(=O)=O)cc1)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H20O7S/c1-14(2,3)22-15(12(16)17,13(18)19)9-10-5-7-11(8-6-10)23(4,20)21/h5-8H,9H2,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | OGGOUCLJXQSTJB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|