C21H25NO7 — CID 146282689
2-[[4-[1-(methoxymethyl)-2-oxo-3-pyridinyl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid (PubChem CID 146282689) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-[[4-[1-(methoxymethyl)-2-oxo-3-pyridinyl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid.
| Compound Name | 2-[[4-[1-(methoxymethyl)-2-oxo-3-pyridinyl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid |
|---|---|
| PubChem CID | 146282689 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[[4-[1-(methoxymethyl)-2-oxo-3-pyridinyl]phenyl]methyl]-2-[(2-methylpropan-2-yl)oxy]propanedioic acid |
| SMILES | COCn1cccc(-c2ccc(CC(OC(C)(C)C)(C(=O)O)C(=O)O)cc2)c1=O |
| InChI | InChI=1S/C21H25NO7/c1-20(2,3)29-21(18(24)25,19(26)27)12-14-7-9-15(10-8-14)16-6-5-11-22(13-28-4)17(16)23/h5-11H,12-13H2,1-4H3,(H,24,25)(H,26,27) |
| InChIKey | NSEKXIHCCCLEDR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|