C27H29N3O7 — CID 59769597
ethyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-(4-nitrophenyl)-2-oxo-1-pyridinyl]methyl]anilino]acetate (PubChem CID 59769597) has the molecular formula C27H29N3O7 and a molecular weight of 507.54 g/mol. Its IUPAC name is ethyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-(4-nitrophenyl)-2-oxo-1-pyridinyl]methyl]anilino]acetate.
| Compound Name | ethyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-(4-nitrophenyl)-2-oxo-1-pyridinyl]methyl]anilino]acetate |
|---|---|
| PubChem CID | 59769597 |
| Molecular Formula | C27H29N3O7 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | ethyl 2-[N-[(2-methylpropan-2-yl)oxycarbonyl]-4-[[3-(4-nitrophenyl)-2-oxo-1-pyridinyl]methyl]anilino]acetate |
| SMILES | CCOC(=O)CN(C(=O)OC(C)(C)C)c1ccc(Cn2cccc(-c3ccc([N+](=O)[O-])cc3)c2=O)cc1 |
| InChI | InChI=1S/C27H29N3O7/c1-5-36-24(31)18-29(26(33)37-27(2,3)4)21-12-8-19(9-13-21)17-28-16-6-7-23(25(28)32)20-10-14-22(15-11-20)30(34)35/h6-16H,5,17-18H2,1-4H3 |
| InChIKey | UOENZHCLMDXGDW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 120.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|