C34H50N6O8 — CID 50936681
tert-butyl 2-[7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4,10-bis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 50936681) has the molecular formula C34H50N6O8 and a molecular weight of 670.81 g/mol. Its IUPAC name is tert-butyl 2-[7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4,10-bis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | tert-butyl 2-[7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4,10-bis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 50936681 |
| Molecular Formula | C34H50N6O8 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.37 |
| IUPAC Name | tert-butyl 2-[7-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-4,10-bis[(4-nitrophenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1CCN(Cc2ccc([N+](=O)[O-])cc2)CCN(CC(=O)OC(C)(C)C)CCN(Cc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C34H50N6O8/c1-33(2,3)47-31(41)25-37-19-15-35(23-27-7-11-29(12-8-27)39(43)44)17-21-38(26-32(42)48-34(4,5)6)22-18-36(16-20-37)24-28-9-13-30(14-10-28)40(45)46/h7-14H,15-26H2,1-6H3 |
| InChIKey | HBVGCQZTVBBABH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 151.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|