C37H60N6O11 — CID 18790421
(4-nitrophenyl) 2-[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]propanoylamino]acetate (PubChem CID 18790421) has the molecular formula C37H60N6O11 and a molecular weight of 764.92 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]propanoylamino]acetate.
| Compound Name | (4-nitrophenyl) 2-[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]propanoylamino]acetate |
|---|---|
| PubChem CID | 18790421 |
| Molecular Formula | C37H60N6O11 |
| Molecular Weight | 764.92 g/mol |
| Exact Mass | 764.43 |
| IUPAC Name | (4-nitrophenyl) 2-[2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]propanoylamino]acetate |
| SMILES | CC(C(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1)N1CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C37H60N6O11/c1-27(34(48)38-23-30(44)51-29-13-11-28(12-14-29)43(49)50)42-21-19-40(25-32(46)53-36(5,6)7)17-15-39(24-31(45)52-35(2,3)4)16-18-41(20-22-42)26-33(47)54-37(8,9)10/h11-14,27H,15-26H2,1-10H3,(H,38,48) |
| InChIKey | CZBOBCRUMUOMBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 190.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|