C12H11N3O8 — CID 141232327
2-[[2-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoacetyl]amino]acetic acid (PubChem CID 141232327) has the molecular formula C12H11N3O8 and a molecular weight of 325.23 g/mol. Its IUPAC name is 2-[[2-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoacetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoacetyl]amino]acetic acid |
|---|---|
| PubChem CID | 141232327 |
| Molecular Formula | C12H11N3O8 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-[[2-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoacetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)C(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H11N3O8/c16-9(17)5-13-11(19)12(20)14-6-10(18)23-8-3-1-7(2-4-8)15(21)22/h1-4H,5-6H2,(H,13,19)(H,14,20)(H,16,17) |
| InChIKey | MROFDGLTAVHLGO-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|