C14H15N3O6 — CID 66628889
(4-nitrophenyl) 2-[[2-[methyl(prop-2-enoyl)amino]acetyl]amino]acetate (PubChem CID 66628889) has the molecular formula C14H15N3O6 and a molecular weight of 321.29 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[[2-[methyl(prop-2-enoyl)amino]acetyl]amino]acetate.
| Compound Name | (4-nitrophenyl) 2-[[2-[methyl(prop-2-enoyl)amino]acetyl]amino]acetate |
|---|---|
| PubChem CID | 66628889 |
| Molecular Formula | C14H15N3O6 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (4-nitrophenyl) 2-[[2-[methyl(prop-2-enoyl)amino]acetyl]amino]acetate |
| SMILES | C=CC(=O)N(C)CC(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H15N3O6/c1-3-13(19)16(2)9-12(18)15-8-14(20)23-11-6-4-10(5-7-11)17(21)22/h3-7H,1,8-9H2,2H3,(H,15,18) |
| InChIKey | OHYFYQSXZOQBAS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|