C15H19BrN4O8 — CID 131872761
methyl (3S)-3-[(2-aminoacetyl)amino]-4-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-4-oxobutanoate;hydrobromide (PubChem CID 131872761) has the molecular formula C15H19BrN4O8 and a molecular weight of 463.24 g/mol. Its IUPAC name is methyl (3S)-3-[(2-aminoacetyl)amino]-4-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-4-oxobutanoate;hydrobromide.
| Compound Name | methyl (3S)-3-[(2-aminoacetyl)amino]-4-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-4-oxobutanoate;hydrobromide |
|---|---|
| PubChem CID | 131872761 |
| Molecular Formula | C15H19BrN4O8 |
| Molecular Weight | 463.24 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | methyl (3S)-3-[(2-aminoacetyl)amino]-4-[[2-(4-nitrophenoxy)-2-oxoethyl]amino]-4-oxobutanoate;hydrobromide |
| SMILES | Br.COC(=O)C[C@H](NC(=O)CN)C(=O)NCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18N4O8.BrH/c1-26-13(21)6-11(18-12(20)7-16)15(23)17-8-14(22)27-10-4-2-9(3-5-10)19(24)25;/h2-5,11H,6-8,16H2,1H3,(H,17,23)(H,18,20);1H/t11-;/m0./s1 |
| InChIKey | HRPJRMAFASPIBJ-MERQFXBCSA-N |
| XLogP | -0.80 |
| TPSA | 179.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.24 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|