C23H29N3O7 — CID 177225488
(4-nitrophenyl) 2-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetate;toluene (PubChem CID 177225488) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetate;toluene.
| Compound Name | (4-nitrophenyl) 2-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetate;toluene |
|---|---|
| PubChem CID | 177225488 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (4-nitrophenyl) 2-[methyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]acetyl]amino]acetate;toluene |
| SMILES | CN(CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)CNC(=O)OC(C)(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C16H21N3O7.C7H8/c1-16(2,3)26-15(22)17-9-13(20)18(4)10-14(21)25-12-7-5-11(6-8-12)19(23)24;1-7-5-3-2-4-6-7/h5-8H,9-10H2,1-4H3,(H,17,22);2-6H,1H3 |
| InChIKey | QQEXXPKILOKYGL-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 128.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|