C25H32N4O7 — CID 100940890
(4-nitrophenyl) N-[(2S)-6-benzamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate (PubChem CID 100940890) has the molecular formula C25H32N4O7 and a molecular weight of 500.55 g/mol. Its IUPAC name is (4-nitrophenyl) N-[(2S)-6-benzamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[(2S)-6-benzamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
|---|---|
| PubChem CID | 100940890 |
| Molecular Formula | C25H32N4O7 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | (4-nitrophenyl) N-[(2S)-6-benzamido-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)c1ccccc1)CNC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H32N4O7/c1-25(2,3)36-24(32)28-19(11-7-8-16-26-22(30)18-9-5-4-6-10-18)17-27-23(31)35-21-14-12-20(13-15-21)29(33)34/h4-6,9-10,12-15,19H,7-8,11,16-17H2,1-3H3,(H,26,30)(H,27,31)(H,28,32)/t19-/m0/s1 |
| InChIKey | NIISOEGYPFTYTD-IBGZPJMESA-N |
| XLogP | 4.18 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|