C13H25N3O6 — CID 135204157
[6-(carboxyamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid (PubChem CID 135204157) has the molecular formula C13H25N3O6 and a molecular weight of 319.36 g/mol. Its IUPAC name is [6-(carboxyamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid.
| Compound Name | [6-(carboxyamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 135204157 |
| Molecular Formula | C13H25N3O6 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [6-(carboxyamino)-1-[(2-methylpropan-2-yl)oxycarbonylamino]hexan-2-yl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)NCC(CCCCNC(=O)O)NC(=O)O |
| InChI | InChI=1S/C13H25N3O6/c1-13(2,3)22-12(21)15-8-9(16-11(19)20)6-4-5-7-14-10(17)18/h9,14,16H,4-8H2,1-3H3,(H,15,21)(H,17,18)(H,19,20) |
| InChIKey | UCSCPEXFPGYOOF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|