C13H26N4O5 — CID 87743332
[(4S)-5-[(2-aminoacetyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamic acid (PubChem CID 87743332) has the molecular formula C13H26N4O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is [(4S)-5-[(2-aminoacetyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamic acid.
| Compound Name | [(4S)-5-[(2-aminoacetyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamic acid |
|---|---|
| PubChem CID | 87743332 |
| Molecular Formula | C13H26N4O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | [(4S)-5-[(2-aminoacetyl)amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)O)CNC(=O)CN |
| InChI | InChI=1S/C13H26N4O5/c1-13(2,3)22-12(21)17-9(8-16-10(18)7-14)5-4-6-15-11(19)20/h9,15H,4-8,14H2,1-3H3,(H,16,18)(H,17,21)(H,19,20)/t9-/m0/s1 |
| InChIKey | JFTVDTBBHLNRGG-VIFPVBQESA-N |
| XLogP | 0.00 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|