C20H41N5O5 — CID 141144922
tert-butyl N-[(2S)-1-(3,5-diaminopentanoylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate (PubChem CID 141144922) has the molecular formula C20H41N5O5 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3,5-diaminopentanoylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3,5-diaminopentanoylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 141144922 |
| Molecular Formula | C20H41N5O5 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3,5-diaminopentanoylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]pentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CNC(=O)CC(N)CCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H41N5O5/c1-19(2,3)29-17(27)23-11-7-8-15(25-18(28)30-20(4,5)6)13-24-16(26)12-14(22)9-10-21/h14-15H,7-13,21-22H2,1-6H3,(H,23,27)(H,24,26)(H,25,28)/t14?,15-/m0/s1 |
| InChIKey | BDHMIVZGWBEVCB-LOACHALJSA-N |
| XLogP | 1.37 |
| TPSA | 157.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|