C15H28N2O5S — CID 140880775
S-[2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate (PubChem CID 140880775) has the molecular formula C15H28N2O5S and a molecular weight of 348.47 g/mol. Its IUPAC name is S-[2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate.
| Compound Name | S-[2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate |
|---|---|
| PubChem CID | 140880775 |
| Molecular Formula | C15H28N2O5S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | S-[2,3-bis[(2-methylpropan-2-yl)oxycarbonylamino]propyl] ethanethioate |
| SMILES | CC(=O)SCC(CNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H28N2O5S/c1-10(18)23-9-11(17-13(20)22-15(5,6)7)8-16-12(19)21-14(2,3)4/h11H,8-9H2,1-7H3,(H,16,19)(H,17,20) |
| InChIKey | QTVPIPQUDOFVBG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|