About (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate
(4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate (PubChem CID 11729363) has the molecular formula C21H22N2O7
and a molecular weight of 414.41 g/mol. Its IUPAC name is (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate.
Molecular Properties
| Compound Name | (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate |
| PubChem CID | 11729363 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate |
| SMILES | CC(C)(C)OC(=O)N(CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H22N2O7/c1-21(2,3)30-20(26)22(18(24)13-15-7-5-4-6-8-15)14-19(25)29-17-11-9-16(10-12-17)23(27)28/h4-12H,13-14H2,1-3H3 |
| InChIKey | BGJNQAKDTVFUQX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate?
The IUPAC name of (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate (CID 11729363) is (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate.
What is the SMILES notation for (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate?
The canonical SMILES for (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate is CC(C)(C)OC(=O)N(CC(=O)Oc1ccc([N+](=O)[O-])cc1)C(=O)Cc1ccccc1.
What is the InChIKey of (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate?
The InChIKey is BGJNQAKDTVFUQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O7/c1-21(2,3)30-20(26)22(18(24)13-15-7-5-4-6-8-15)14-19(25)29-17-11-9-16(10-12-17)23(27)28/h4-12H,13-14H2,1-3H3.
What are the key properties of (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate?
(4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate has a molecular weight of 414.41 g/mol, XLogP of 3.51, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl) 2-[(2-methylpropan-2-yl)oxycarbonyl-(2-phenylacetyl)amino]acetate is sourced from PubChem (CID 11729363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).