About tert-butyl (4-nitrophenyl) carbonate;ethane
tert-butyl (4-nitrophenyl) carbonate;ethane (PubChem CID 143603292) has the molecular formula C13H19NO5
and a molecular weight of 269.30 g/mol. Its IUPAC name is tert-butyl (4-nitrophenyl) carbonate;ethane.
Molecular Properties
| Compound Name | tert-butyl (4-nitrophenyl) carbonate;ethane |
| PubChem CID | 143603292 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | tert-butyl (4-nitrophenyl) carbonate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H13NO5.C2H6/c1-11(2,3)17-10(13)16-9-6-4-8(5-7-9)12(14)15;1-2/h4-7H,1-3H3;1-2H3 |
| InChIKey | ZJCZEFTYWQPQNL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4-nitrophenyl) carbonate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4-nitrophenyl) carbonate;ethane?
The IUPAC name of tert-butyl (4-nitrophenyl) carbonate;ethane (CID 143603292) is tert-butyl (4-nitrophenyl) carbonate;ethane.
What is the SMILES notation for tert-butyl (4-nitrophenyl) carbonate;ethane?
The canonical SMILES for tert-butyl (4-nitrophenyl) carbonate;ethane is CC.CC(C)(C)OC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of tert-butyl (4-nitrophenyl) carbonate;ethane?
The InChIKey is ZJCZEFTYWQPQNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO5.C2H6/c1-11(2,3)17-10(13)16-9-6-4-8(5-7-9)12(14)15;1-2/h4-7H,1-3H3;1-2H3.
What are the key properties of tert-butyl (4-nitrophenyl) carbonate;ethane?
tert-butyl (4-nitrophenyl) carbonate;ethane has a molecular weight of 269.30 g/mol, XLogP of 3.93, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4-nitrophenyl) carbonate;ethane is sourced from PubChem (CID 143603292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).