C18H21N3O7 — CID 149150815
tert-butyl 6-amino-3-[(4-nitrophenoxy)carbonyloxymethyl]-2H-pyridine-1-carboxylate (PubChem CID 149150815) has the molecular formula C18H21N3O7 and a molecular weight of 391.38 g/mol. Its IUPAC name is tert-butyl 6-amino-3-[(4-nitrophenoxy)carbonyloxymethyl]-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-amino-3-[(4-nitrophenoxy)carbonyloxymethyl]-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 149150815 |
| Molecular Formula | C18H21N3O7 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | tert-butyl 6-amino-3-[(4-nitrophenoxy)carbonyloxymethyl]-2H-pyridine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(COC(=O)Oc2ccc([N+](=O)[O-])cc2)=CC=C1N |
| InChI | InChI=1S/C18H21N3O7/c1-18(2,3)28-16(22)20-10-12(4-9-15(20)19)11-26-17(23)27-14-7-5-13(6-8-14)21(24)25/h4-9H,10-11,19H2,1-3H3 |
| InChIKey | OEJUIWYFVZDXSP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 134.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|