C15H15N3O6 — CID 135384155
3-O-tert-butyl 1-O-(4-nitrophenyl) pyrazole-1,3-dicarboxylate (PubChem CID 135384155) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 3-O-tert-butyl 1-O-(4-nitrophenyl) pyrazole-1,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 1-O-(4-nitrophenyl) pyrazole-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135384155 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 3-O-tert-butyl 1-O-(4-nitrophenyl) pyrazole-1,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccn(C(=O)Oc2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C15H15N3O6/c1-15(2,3)24-13(19)12-8-9-17(16-12)14(20)23-11-6-4-10(5-7-11)18(21)22/h4-9H,1-3H3 |
| InChIKey | DFVHHMBAJCCQQH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 113.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|