C24H21ClN8O10 — CID 161430858
(4-nitrophenyl) 3-acetamidopyrazole-1-carboxylate;(4-nitrophenyl) carbonochloridate;N-(1H-pyrazol-5-yl)acetamide (PubChem CID 161430858) has the molecular formula C24H21ClN8O10 and a molecular weight of 616.93 g/mol. Its IUPAC name is (4-nitrophenyl) 3-acetamidopyrazole-1-carboxylate;(4-nitrophenyl) carbonochloridate;N-(1H-pyrazol-5-yl)acetamide.
| Compound Name | (4-nitrophenyl) 3-acetamidopyrazole-1-carboxylate;(4-nitrophenyl) carbonochloridate;N-(1H-pyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 161430858 |
| Molecular Formula | C24H21ClN8O10 |
| Molecular Weight | 616.93 g/mol |
| Exact Mass | 616.11 |
| IUPAC Name | (4-nitrophenyl) 3-acetamidopyrazole-1-carboxylate;(4-nitrophenyl) carbonochloridate;N-(1H-pyrazol-5-yl)acetamide |
| SMILES | CC(=O)Nc1ccn(C(=O)Oc2ccc([N+](=O)[O-])cc2)n1.CC(=O)Nc1ccn[nH]1.O=C(Cl)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10N4O5.C7H4ClNO4.C5H7N3O/c1-8(17)13-11-6-7-15(14-11)12(18)21-10-4-2-9(3-5-10)16(19)20;8-7(10)13-6-3-1-5(2-4-6)9(11)12;1-4(9)7-5-2-3-6-8-5/h2-7H,1H3,(H,13,14,17);1-4H;2-3H,1H3,(H2,6,7,8,9) |
| InChIKey | VXZJGDXROQDMAR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 243.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.93 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|