C9H9N5O3 — CID 61393253
1-methyl-4-nitro-N-(1H-pyrazol-5-yl)pyrrole-2-carboxamide (PubChem CID 61393253) has the molecular formula C9H9N5O3 and a molecular weight of 235.20 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(1H-pyrazol-5-yl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-nitro-N-(1H-pyrazol-5-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61393253 |
| Molecular Formula | C9H9N5O3 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 1-methyl-4-nitro-N-(1H-pyrazol-5-yl)pyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C9H9N5O3/c1-13-5-6(14(16)17)4-7(13)9(15)11-8-2-3-10-12-8/h2-5H,1H3,(H2,10,11,12,15) |
| InChIKey | SASXSAIPPYPQPM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|