C13H12ClN5O3S — CID 118706626
1-(4-chlorophenyl)-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]thiourea (PubChem CID 118706626) has the molecular formula C13H12ClN5O3S and a molecular weight of 353.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 118706626 |
| Molecular Formula | C13H12ClN5O3S |
| Molecular Weight | 353.79 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]thiourea |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H12ClN5O3S/c1-18-7-10(19(21)22)6-11(18)12(20)16-17-13(23)15-9-4-2-8(14)3-5-9/h2-7H,1H3,(H,16,20)(H2,15,17,23) |
| InChIKey | JBEJHDRCSOHWMN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|