C13H11F2N3O4 — CID 18102127
N-[4-(difluoromethoxy)phenyl]-1-methyl-4-nitropyrrole-2-carboxamide (PubChem CID 18102127) has the molecular formula C13H11F2N3O4 and a molecular weight of 311.24 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-1-methyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-1-methyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18102127 |
| Molecular Formula | C13H11F2N3O4 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-1-methyl-4-nitropyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H11F2N3O4/c1-17-7-9(18(20)21)6-11(17)12(19)16-8-2-4-10(5-3-8)22-13(14)15/h2-7,13H,1H3,(H,16,19) |
| InChIKey | QNNRKIJNSNUXLY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|