C13H12N4O5 — CID 22096757
4-amino-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 22096757) has the molecular formula C13H12N4O5 and a molecular weight of 304.26 g/mol. Its IUPAC name is 4-amino-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-amino-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 22096757 |
| Molecular Formula | C13H12N4O5 |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-amino-3-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)Nc1cc(C(=O)O)ccc1N |
| InChI | InChI=1S/C13H12N4O5/c1-16-6-8(17(21)22)5-11(16)12(18)15-10-4-7(13(19)20)2-3-9(10)14/h2-6H,14H2,1H3,(H,15,18)(H,19,20) |
| InChIKey | ILKSITUCTMCCLU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 140.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|