About 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate
3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate (PubChem CID 88551647) has the molecular formula C15H10N2O7
and a molecular weight of 330.25 g/mol. Its IUPAC name is 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate.
Molecular Properties
| Compound Name | 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate |
| PubChem CID | 88551647 |
| Molecular Formula | C15H10N2O7 |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate |
| SMILES | O=Nc1ccc(OC(=O)CC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C15H10N2O7/c18-14(23-12-5-1-10(16-20)2-6-12)9-15(19)24-13-7-3-11(4-8-13)17(21)22/h1-8H,9H2 |
| InChIKey | VZUWDJDZZUJUSI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 125.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate?
The IUPAC name of 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate (CID 88551647) is 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate.
What is the SMILES notation for 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate?
The canonical SMILES for 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate is O=Nc1ccc(OC(=O)CC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate?
The InChIKey is VZUWDJDZZUJUSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O7/c18-14(23-12-5-1-10(16-20)2-6-12)9-15(19)24-13-7-3-11(4-8-13)17(21)22/h1-8H,9H2.
What are the key properties of 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate?
3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate has a molecular weight of 330.25 g/mol, XLogP of 2.89, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-O-(4-nitrophenyl) 1-O-(4-nitrosophenyl) propanedioate is sourced from PubChem (CID 88551647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).