About [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate
[2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate (PubChem CID 175037095) has the molecular formula C16H12N2O8
and a molecular weight of 360.28 g/mol. Its IUPAC name is [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate.
Molecular Properties
| Compound Name | [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate |
| PubChem CID | 175037095 |
| Molecular Formula | C16H12N2O8 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)OCC(=O)Oc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N2O8/c19-15(9-11-1-3-12(4-2-11)17(21)22)25-10-16(20)26-14-7-5-13(6-8-14)18(23)24/h1-8H,9-10H2 |
| InChIKey | RNTYTLMHZUWIIE-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate?
The IUPAC name of [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate (CID 175037095) is [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate.
What is the SMILES notation for [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate?
The canonical SMILES for [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate is O=C(Cc1ccc([N+](=O)[O-])cc1)OCC(=O)Oc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate?
The InChIKey is RNTYTLMHZUWIIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O8/c19-15(9-11-1-3-12(4-2-11)17(21)22)25-10-16(20)26-14-7-5-13(6-8-14)18(23)24/h1-8H,9-10H2.
What are the key properties of [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate?
[2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate has a molecular weight of 360.28 g/mol, XLogP of 2.19, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-nitrophenoxy)-2-oxoethyl] 2-(4-nitrophenyl)acetate is sourced from PubChem (CID 175037095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).