About 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate
2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate (PubChem CID 175076567) has the molecular formula C12H16N2O5
and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate.
Molecular Properties
| Compound Name | 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate |
| PubChem CID | 175076567 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate |
| SMILES | NCCOCCOC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H16N2O5/c13-5-6-18-7-8-19-12(15)9-10-1-3-11(4-2-10)14(16)17/h1-4H,5-9,13H2 |
| InChIKey | RCGSWHPCRVTUNJ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate?
The IUPAC name of 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate (CID 175076567) is 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate.
What is the SMILES notation for 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate?
The canonical SMILES for 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate is NCCOCCOC(=O)Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate?
The InChIKey is RCGSWHPCRVTUNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O5/c13-5-6-18-7-8-19-12(15)9-10-1-3-11(4-2-10)14(16)17/h1-4H,5-9,13H2.
What are the key properties of 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate?
2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate has a molecular weight of 268.27 g/mol, XLogP of 0.66, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)ethyl 2-(4-nitrophenyl)acetate is sourced from PubChem (CID 175076567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).