C23H28N6O6 — CID 26008277
(2S)-2-[4-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-1,4-diazepan-1-yl]-N-(4-nitrophenyl)propanamide (PubChem CID 26008277) has the molecular formula C23H28N6O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-1,4-diazepan-1-yl]-N-(4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[4-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-1,4-diazepan-1-yl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 26008277 |
| Molecular Formula | C23H28N6O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | (2S)-2-[4-[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]-1,4-diazepan-1-yl]-N-(4-nitrophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)N1CCCN([C@@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C23H28N6O6/c1-16(22(30)24-18-4-8-20(9-5-18)28(32)33)26-12-3-13-27(15-14-26)17(2)23(31)25-19-6-10-21(11-7-19)29(34)35/h4-11,16-17H,3,12-15H2,1-2H3,(H,24,30)(H,25,31)/t16-,17-/m0/s1 |
| InChIKey | BNIQKKOZSUQUSX-IRXDYDNUSA-N |
| XLogP | 2.86 |
| TPSA | 150.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|