C15H21N3O4 — CID 25401165
(2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-(4-nitrophenyl)propanamide (PubChem CID 25401165) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is (2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-(4-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 25401165 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | (2R)-2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-N-(4-nitrophenyl)propanamide |
| SMILES | C[C@@H]1CN([C@H](C)C(=O)Nc2ccc([N+](=O)[O-])cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H21N3O4/c1-10-8-17(9-11(2)22-10)12(3)15(19)16-13-4-6-14(7-5-13)18(20)21/h4-7,10-12H,8-9H2,1-3H3,(H,16,19)/t10-,11+,12-/m1/s1 |
| InChIKey | NELWIEWNKRGBRE-GRYCIOLGSA-N |
| XLogP | 2.03 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|