C14H19N3O5S — CID 95334760
(2S)-2-(1,1-dioxo-1,4-thiazepan-4-yl)-N-(4-nitrophenyl)propanamide (PubChem CID 95334760) has the molecular formula C14H19N3O5S and a molecular weight of 341.39 g/mol. Its IUPAC name is (2S)-2-(1,1-dioxo-1,4-thiazepan-4-yl)-N-(4-nitrophenyl)propanamide.
| Compound Name | (2S)-2-(1,1-dioxo-1,4-thiazepan-4-yl)-N-(4-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 95334760 |
| Molecular Formula | C14H19N3O5S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | (2S)-2-(1,1-dioxo-1,4-thiazepan-4-yl)-N-(4-nitrophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H19N3O5S/c1-11(16-7-2-9-23(21,22)10-8-16)14(18)15-12-3-5-13(6-4-12)17(19)20/h3-6,11H,2,7-10H2,1H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | CTXKJPJYLMPEQB-NSHDSACASA-N |
| XLogP | 1.04 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|