C31H48N6O11 — CID 134552198
methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-10-[2-[2-methylpropyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate (PubChem CID 134552198) has the molecular formula C31H48N6O11 and a molecular weight of 680.76 g/mol. Its IUPAC name is methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-10-[2-[2-methylpropyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate.
| Compound Name | methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-10-[2-[2-methylpropyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
|---|---|
| PubChem CID | 134552198 |
| Molecular Formula | C31H48N6O11 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | methyl 2-[4,7-bis(2-methoxy-2-oxoethyl)-10-[2-[2-methylpropyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate |
| SMILES | COC(=O)CN1CCN(CC(=O)OC)CCN(CC(=O)N(CC(=O)Oc2ccc([N+](=O)[O-])cc2)CC(C)C)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C31H48N6O11/c1-24(2)18-36(23-31(42)48-26-8-6-25(7-9-26)37(43)44)27(38)19-32-10-12-33(20-28(39)45-3)14-16-35(22-30(41)47-5)17-15-34(13-11-32)21-29(40)46-4/h6-9,24H,10-23H2,1-5H3 |
| InChIKey | OLEZAFYVEYEKHH-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 181.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|