C23H41N5O9 — CID 134552153
2-[ethyl-[2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid (PubChem CID 134552153) has the molecular formula C23H41N5O9 and a molecular weight of 531.61 g/mol. Its IUPAC name is 2-[ethyl-[2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 134552153 |
| Molecular Formula | C23H41N5O9 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | 2-[ethyl-[2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C(=O)CN1CCN(CC(=O)OC)CCN(CC(=O)OC)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C23H41N5O9/c1-5-28(15-20(30)31)19(29)14-24-6-8-25(16-21(32)35-2)10-12-27(18-23(34)37-4)13-11-26(9-7-24)17-22(33)36-3/h5-18H2,1-4H3,(H,30,31) |
| InChIKey | NXTWBZOQBJATNN-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 149.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|