C12H23N3O3 — CID 43397406
2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]acetic acid (PubChem CID 43397406) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]acetic acid.
| Compound Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 43397406 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | 2-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]acetic acid |
| SMILES | CCN(CC)C(=O)CN1CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O3/c1-3-15(4-2)11(16)9-13-5-7-14(8-6-13)10-12(17)18/h3-10H2,1-2H3,(H,17,18) |
| InChIKey | SXWNSMRBMGFTIW-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |