C21H40N4O8 — CID 143494242
ethane;2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 143494242) has the molecular formula C21H40N4O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is ethane;2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | ethane;2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 143494242 |
| Molecular Formula | C21H40N4O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | ethane;2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC.COC(=O)CN1CCN(CC(=O)O)CCN(CC(=O)OC)CCN(CC(=O)OC)CC1 |
| InChI | InChI=1S/C19H34N4O8.C2H6/c1-29-17(26)13-21-6-4-20(12-16(24)25)5-7-22(14-18(27)30-2)9-11-23(10-8-21)15-19(28)31-3;1-2/h4-15H2,1-3H3,(H,24,25);1-2H3 |
| InChIKey | BCRWYSWBTZIGGC-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|