C31H38N6O11 — CID 156905095
2-[(8Z)-4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid (PubChem CID 156905095) has the molecular formula C31H38N6O11 and a molecular weight of 670.68 g/mol. Its IUPAC name is 2-[(8Z)-4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid.
| Compound Name | 2-[(8Z)-4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 156905095 |
| Molecular Formula | C31H38N6O11 |
| Molecular Weight | 670.68 g/mol |
| Exact Mass | 670.26 |
| IUPAC Name | 2-[(8Z)-4-[2-[benzyl-[2-(4-nitrophenoxy)-2-oxoethyl]amino]-2-oxoethyl]-7,10-bis(carboxymethyl)-1,4,7,10-tetrazacyclododec-8-en-1-yl]acetic acid |
| SMILES | O=C(O)CN1/C=C\N(CC(=O)O)CCN(CC(=O)N(CC(=O)Oc2ccc([N+](=O)[O-])cc2)Cc2ccccc2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C31H38N6O11/c38-27(36(18-24-4-2-1-3-5-24)23-31(45)48-26-8-6-25(7-9-26)37(46)47)19-32-10-12-33(20-28(39)40)14-16-35(22-30(43)44)17-15-34(13-11-32)21-29(41)42/h1-9,14,16H,10-13,15,17-23H2,(H,39,40)(H,41,42)(H,43,44)/b16-14- |
| InChIKey | LTULTHATGQFTDJ-PEZBUJJGSA-N |
| XLogP | 0.48 |
| TPSA | 214.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.68 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|