C23H33N5O10 — CID 59622857
2-[4-[1-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propan-2-yl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid (PubChem CID 59622857) has the molecular formula C23H33N5O10 and a molecular weight of 539.54 g/mol. Its IUPAC name is 2-[4-[1-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propan-2-yl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid.
| Compound Name | 2-[4-[1-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propan-2-yl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
|---|---|
| PubChem CID | 59622857 |
| Molecular Formula | C23H33N5O10 |
| Molecular Weight | 539.54 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-[4-[1-[bis(carboxymethyl)amino]-3-(4-nitrophenyl)propan-2-yl]-7-(carboxymethyl)-1,4,7-triazonan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CCN(C(Cc2ccc([N+](=O)[O-])cc2)CN(CC(=O)O)CC(=O)O)CC1 |
| InChI | InChI=1S/C23H33N5O10/c29-20(30)13-24-5-6-25(14-21(31)32)8-10-27(9-7-24)19(12-26(15-22(33)34)16-23(35)36)11-17-1-3-18(4-2-17)28(37)38/h1-4,19H,5-16H2,(H,29,30)(H,31,32)(H,33,34)(H,35,36) |
| InChIKey | GYIBZBKSUGSUSE-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 205.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.54 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|