C29H44N6O12 — CID 160679916
2-[4-[2-[bis(carboxymethyl)amino]-5-(4-nitrophenyl)pentyl]-7,10-dimethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;bis(carbon dioxide) (PubChem CID 160679916) has the molecular formula C29H44N6O12 and a molecular weight of 668.70 g/mol. Its IUPAC name is 2-[4-[2-[bis(carboxymethyl)amino]-5-(4-nitrophenyl)pentyl]-7,10-dimethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;bis(carbon dioxide).
| Compound Name | 2-[4-[2-[bis(carboxymethyl)amino]-5-(4-nitrophenyl)pentyl]-7,10-dimethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;bis(carbon dioxide) |
|---|---|
| PubChem CID | 160679916 |
| Molecular Formula | C29H44N6O12 |
| Molecular Weight | 668.70 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 2-[4-[2-[bis(carboxymethyl)amino]-5-(4-nitrophenyl)pentyl]-7,10-dimethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid;bis(carbon dioxide) |
| SMILES | CN1CCN(C)CCN(CC(CCCc2ccc([N+](=O)[O-])cc2)N(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC1.O=C=O.O=C=O |
| InChI | InChI=1S/C27H44N6O8.2CO2/c1-28-10-11-29(2)13-15-31(19-25(34)35)17-16-30(14-12-28)18-24(32(20-26(36)37)21-27(38)39)5-3-4-22-6-8-23(9-7-22)33(40)41;2*2-1-3/h6-9,24H,3-5,10-21H2,1-2H3,(H,34,35)(H,36,37)(H,38,39);; |
| InChIKey | RNZTYYLJIHFNJI-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 239.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.70 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|